C10H17BrClN3O2S — CID 106316050
N-[3-(bromomethyl)pentan-3-yl]-4-chloro-1-methylpyrazole-5-sulfonamide (PubChem CID 106316050) has the molecular formula C10H17BrClN3O2S and a molecular weight of 358.69 g/mol. Its IUPAC name is N-[3-(bromomethyl)pentan-3-yl]-4-chloro-1-methylpyrazole-5-sulfonamide.
| Compound Name | N-[3-(bromomethyl)pentan-3-yl]-4-chloro-1-methylpyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106316050 |
| Molecular Formula | C10H17BrClN3O2S |
| Molecular Weight | 358.69 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | N-[3-(bromomethyl)pentan-3-yl]-4-chloro-1-methylpyrazole-5-sulfonamide |
| SMILES | CCC(CC)(CBr)NS(=O)(=O)c1c(Cl)cnn1C |
| InChI | InChI=1S/C10H17BrClN3O2S/c1-4-10(5-2,7-11)14-18(16,17)9-8(12)6-13-15(9)3/h6,14H,4-5,7H2,1-3H3 |
| InChIKey | CTUFODUJGPIOAB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.69 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|