C11H15NO2 — CID 10631631
(3S,6S)-2,3-dimethyl-6-phenyl-1,5,2-dioxazinane (PubChem CID 10631631) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (3S,6S)-2,3-dimethyl-6-phenyl-1,5,2-dioxazinane.
| Compound Name | (3S,6S)-2,3-dimethyl-6-phenyl-1,5,2-dioxazinane |
|---|---|
| PubChem CID | 10631631 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (3S,6S)-2,3-dimethyl-6-phenyl-1,5,2-dioxazinane |
| SMILES | C[C@H]1CO[C@H](c2ccccc2)ON1C |
| InChI | InChI=1S/C11H15NO2/c1-9-8-13-11(14-12(9)2)10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3/t9-,11-/m0/s1 |
| InChIKey | HSQJSPFCQFFYKS-ONGXEEELSA-N |
| XLogP | 1.97 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |