C9H10F5NO — CID 106316946
2,2,3,3,3-pentafluoro-1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-one (PubChem CID 106316946) has the molecular formula C9H10F5NO and a molecular weight of 243.17 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-one.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 106316946 |
| Molecular Formula | C9H10F5NO |
| Molecular Weight | 243.17 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-one |
| SMILES | CC1=CCCN(C(=O)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C9H10F5NO/c1-6-3-2-4-15(5-6)7(16)8(10,11)9(12,13)14/h3H,2,4-5H2,1H3 |
| InChIKey | UOTYVNWIOSEKCS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.17 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|