C12H20N4O2S — CID 106317226
3-[4-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]pyrazol-1-yl]propan-1-amine (PubChem CID 106317226) has the molecular formula C12H20N4O2S and a molecular weight of 284.39 g/mol. Its IUPAC name is 3-[4-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]pyrazol-1-yl]propan-1-amine.
| Compound Name | 3-[4-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]pyrazol-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 106317226 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3-[4-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]pyrazol-1-yl]propan-1-amine |
| SMILES | CC1=CCCN(S(=O)(=O)c2cnn(CCCN)c2)C1 |
| InChI | InChI=1S/C12H20N4O2S/c1-11-4-2-7-16(9-11)19(17,18)12-8-14-15(10-12)6-3-5-13/h4,8,10H,2-3,5-7,9,13H2,1H3 |
| InChIKey | DQMWVRNXZHMXDU-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|