C13H20N4OS — CID 106317405
[4-amino-2-(propylamino)-1,3-thiazol-5-yl]-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 106317405) has the molecular formula C13H20N4OS and a molecular weight of 280.40 g/mol. Its IUPAC name is [4-amino-2-(propylamino)-1,3-thiazol-5-yl]-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | [4-amino-2-(propylamino)-1,3-thiazol-5-yl]-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 106317405 |
| Molecular Formula | C13H20N4OS |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | [4-amino-2-(propylamino)-1,3-thiazol-5-yl]-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | CCCNc1nc(N)c(C(=O)N2CCC=C(C)C2)s1 |
| InChI | InChI=1S/C13H20N4OS/c1-3-6-15-13-16-11(14)10(19-13)12(18)17-7-4-5-9(2)8-17/h5H,3-4,6-8,14H2,1-2H3,(H,15,16) |
| InChIKey | MDRHCRZJIZQMHK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|