About [4-amino-2-(propylamino)-1,3-thiazol-5-yl]-(2,3-dimethylthiomorpholin-4-yl)methanone
[4-amino-2-(propylamino)-1,3-thiazol-5-yl]-(2,3-dimethylthiomorpholin-4-yl)methanone (PubChem CID 116673418) has the molecular formula C13H22N4OS2
and a molecular weight of 314.48 g/mol. Its IUPAC name is [4-amino-2-(propylamino)-1,3-thiazol-5-yl]-(2,3-dimethylthiomorpholin-4-yl)methanone.
Molecular Properties
| Compound Name | [4-amino-2-(propylamino)-1,3-thiazol-5-yl]-(2,3-dimethylthiomorpholin-4-yl)methanone |
| PubChem CID | 116673418 |
| Molecular Formula | C13H22N4OS2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | [4-amino-2-(propylamino)-1,3-thiazol-5-yl]-(2,3-dimethylthiomorpholin-4-yl)methanone |
| SMILES | CCCNc1nc(N)c(C(=O)N2CCSC(C)C2C)s1 |
| InChI | InChI=1S/C13H22N4OS2/c1-4-5-15-13-16-11(14)10(20-13)12(18)17-6-7-19-9(3)8(17)2/h8-9H,4-7,14H2,1-3H3,(H,15,16) |
| InChIKey | REKHLMWNQJKISY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-amino-2-(propylamino)-1,3-thiazol-5-yl]-(2,3-dimethylthiomorpholin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-amino-2-(propylamino)-1,3-thiazol-5-yl]-(2,3-dimethylthiomorpholin-4-yl)methanone?
The IUPAC name of [4-amino-2-(propylamino)-1,3-thiazol-5-yl]-(2,3-dimethylthiomorpholin-4-yl)methanone (CID 116673418) is [4-amino-2-(propylamino)-1,3-thiazol-5-yl]-(2,3-dimethylthiomorpholin-4-yl)methanone.
What is the SMILES notation for [4-amino-2-(propylamino)-1,3-thiazol-5-yl]-(2,3-dimethylthiomorpholin-4-yl)methanone?
The canonical SMILES for [4-amino-2-(propylamino)-1,3-thiazol-5-yl]-(2,3-dimethylthiomorpholin-4-yl)methanone is CCCNc1nc(N)c(C(=O)N2CCSC(C)C2C)s1.
What is the InChIKey of [4-amino-2-(propylamino)-1,3-thiazol-5-yl]-(2,3-dimethylthiomorpholin-4-yl)methanone?
The InChIKey is REKHLMWNQJKISY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4OS2/c1-4-5-15-13-16-11(14)10(20-13)12(18)17-6-7-19-9(3)8(17)2/h8-9H,4-7,14H2,1-3H3,(H,15,16).
What are the key properties of [4-amino-2-(propylamino)-1,3-thiazol-5-yl]-(2,3-dimethylthiomorpholin-4-yl)methanone?
[4-amino-2-(propylamino)-1,3-thiazol-5-yl]-(2,3-dimethylthiomorpholin-4-yl)methanone has a molecular weight of 314.48 g/mol, XLogP of 2.51, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-amino-2-(propylamino)-1,3-thiazol-5-yl]-(2,3-dimethylthiomorpholin-4-yl)methanone is sourced from PubChem (CID 116673418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).