C10H15NO3 — CID 10631787
(2R,3S,6S)-3-isocyanato-2-methyl-6-propan-2-yloxy-3,6-dihydro-2H-pyran (PubChem CID 10631787) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is (2R,3S,6S)-3-isocyanato-2-methyl-6-propan-2-yloxy-3,6-dihydro-2H-pyran.
| Compound Name | (2R,3S,6S)-3-isocyanato-2-methyl-6-propan-2-yloxy-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 10631787 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | (2R,3S,6S)-3-isocyanato-2-methyl-6-propan-2-yloxy-3,6-dihydro-2H-pyran |
| SMILES | CC(C)O[C@@H]1C=C[C@H](N=C=O)[C@@H](C)O1 |
| InChI | InChI=1S/C10H15NO3/c1-7(2)13-10-5-4-9(11-6-12)8(3)14-10/h4-5,7-10H,1-3H3/t8-,9+,10+/m1/s1 |
| InChIKey | GUOIKAMHFZFPKD-UTLUCORTSA-N |
| XLogP | 1.42 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|