C9H16O5S — CID 101167955
[(3R,6S)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl] methanesulfonate (PubChem CID 101167955) has the molecular formula C9H16O5S and a molecular weight of 236.29 g/mol. Its IUPAC name is [(3R,6S)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl] methanesulfonate.
| Compound Name | [(3R,6S)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 101167955 |
| Molecular Formula | C9H16O5S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | [(3R,6S)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl] methanesulfonate |
| SMILES | CC(C)O[C@H]1C=C[C@@H](OS(C)(=O)=O)CO1 |
| InChI | InChI=1S/C9H16O5S/c1-7(2)13-9-5-4-8(6-12-9)14-15(3,10)11/h4-5,7-9H,6H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | SQIUBDTZQOSBPW-BDAKNGLRSA-N |
| XLogP | 0.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|