About cis-(1R,3S)-3-[[2-(2-methoxyethylsulfanyl)acetyl]amino]cyclopentane-1-carboxylic acid
cis-(1R,3S)-3-[[2-(2-methoxyethylsulfanyl)acetyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 106320687) has the molecular formula C11H19NO4S
and a molecular weight of 261.34 g/mol. Its IUPAC name is cis-(1R,3S)-3-[[2-(2-methoxyethylsulfanyl)acetyl]amino]cyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | cis-(1R,3S)-3-[[2-(2-methoxyethylsulfanyl)acetyl]amino]cyclopentane-1-carboxylic acid |
| PubChem CID | 106320687 |
| Molecular Formula | C11H19NO4S |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | cis-(1R,3S)-3-[[2-(2-methoxyethylsulfanyl)acetyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | COCCSCC(=O)N[C@H]1CC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C11H19NO4S/c1-16-4-5-17-7-10(13)12-9-3-2-8(6-9)11(14)15/h8-9H,2-7H2,1H3,(H,12,13)(H,14,15)/t8-,9+/m1/s1 |
| InChIKey | CIZDKAVBWSSOLV-BDAKNGLRSA-N |
| XLogP | 0.74 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cis-(1R,3S)-3-[[2-(2-methoxyethylsulfanyl)acetyl]amino]cyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,3S)-3-[[2-(2-methoxyethylsulfanyl)acetyl]amino]cyclopentane-1-carboxylic acid?
The IUPAC name of cis-(1R,3S)-3-[[2-(2-methoxyethylsulfanyl)acetyl]amino]cyclopentane-1-carboxylic acid (CID 106320687) is cis-(1R,3S)-3-[[2-(2-methoxyethylsulfanyl)acetyl]amino]cyclopentane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,3S)-3-[[2-(2-methoxyethylsulfanyl)acetyl]amino]cyclopentane-1-carboxylic acid?
The canonical SMILES for cis-(1R,3S)-3-[[2-(2-methoxyethylsulfanyl)acetyl]amino]cyclopentane-1-carboxylic acid is COCCSCC(=O)N[C@H]1CC[C@@H](C(=O)O)C1.
What is the InChIKey of cis-(1R,3S)-3-[[2-(2-methoxyethylsulfanyl)acetyl]amino]cyclopentane-1-carboxylic acid?
The InChIKey is CIZDKAVBWSSOLV-BDAKNGLRSA-N. The full InChI is InChI=1S/C11H19NO4S/c1-16-4-5-17-7-10(13)12-9-3-2-8(6-9)11(14)15/h8-9H,2-7H2,1H3,(H,12,13)(H,14,15)/t8-,9+/m1/s1.
What are the key properties of cis-(1R,3S)-3-[[2-(2-methoxyethylsulfanyl)acetyl]amino]cyclopentane-1-carboxylic acid?
cis-(1R,3S)-3-[[2-(2-methoxyethylsulfanyl)acetyl]amino]cyclopentane-1-carboxylic acid has a molecular weight of 261.34 g/mol, XLogP of 0.74, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,3S)-3-[[2-(2-methoxyethylsulfanyl)acetyl]amino]cyclopentane-1-carboxylic acid is sourced from PubChem (CID 106320687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).