C13H22O2 — CID 10632273
7-but-3-enyl-7-methyl-1,4-dioxaspiro[4.5]decane (PubChem CID 10632273) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 7-but-3-enyl-7-methyl-1,4-dioxaspiro[4.5]decane.
| Compound Name | 7-but-3-enyl-7-methyl-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 10632273 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 7-but-3-enyl-7-methyl-1,4-dioxaspiro[4.5]decane |
| SMILES | C=CCCC1(C)CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C13H22O2/c1-3-4-6-12(2)7-5-8-13(11-12)14-9-10-15-13/h3H,1,4-11H2,2H3 |
| InChIKey | GCTUIEJDTHLGID-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|