C14H22O2 — CID 71763484
(7S,8S)-7-ethenyl-7-methyl-8-prop-1-en-2-yl-1,4-dioxaspiro[4.5]decane (PubChem CID 71763484) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (7S,8S)-7-ethenyl-7-methyl-8-prop-1-en-2-yl-1,4-dioxaspiro[4.5]decane.
| Compound Name | (7S,8S)-7-ethenyl-7-methyl-8-prop-1-en-2-yl-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 71763484 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (7S,8S)-7-ethenyl-7-methyl-8-prop-1-en-2-yl-1,4-dioxaspiro[4.5]decane |
| SMILES | C=C[C@]1(C)CC2(CC[C@H]1C(=C)C)OCCO2 |
| InChI | InChI=1S/C14H22O2/c1-5-13(4)10-14(15-8-9-16-14)7-6-12(13)11(2)3/h5,12H,1-2,6-10H2,3-4H3/t12-,13+/m0/s1 |
| InChIKey | CTRGTOAYZCELOQ-QWHCGFSZSA-N |
| XLogP | 3.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|