About 8,8-bis(prop-2-enyl)-1,4-dioxaspiro[4.5]decane
8,8-bis(prop-2-enyl)-1,4-dioxaspiro[4.5]decane (PubChem CID 567107) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is 8,8-bis(prop-2-enyl)-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8,8-bis(prop-2-enyl)-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 567107 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 8,8-bis(prop-2-enyl)-1,4-dioxaspiro[4.5]decane |
| SMILES | C=CCC1(CC=C)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C14H22O2/c1-3-5-13(6-4-2)7-9-14(10-8-13)15-11-12-16-14/h3-4H,1-2,5-12H2 |
| InChIKey | LRCQOLXOQFEYRY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8,8-bis(prop-2-enyl)-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-bis(prop-2-enyl)-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 8,8-bis(prop-2-enyl)-1,4-dioxaspiro[4.5]decane (CID 567107) is 8,8-bis(prop-2-enyl)-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 8,8-bis(prop-2-enyl)-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 8,8-bis(prop-2-enyl)-1,4-dioxaspiro[4.5]decane is C=CCC1(CC=C)CCC2(CC1)OCCO2.
What is the InChIKey of 8,8-bis(prop-2-enyl)-1,4-dioxaspiro[4.5]decane?
The InChIKey is LRCQOLXOQFEYRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2/c1-3-5-13(6-4-2)7-9-14(10-8-13)15-11-12-16-14/h3-4H,1-2,5-12H2.
What are the key properties of 8,8-bis(prop-2-enyl)-1,4-dioxaspiro[4.5]decane?
8,8-bis(prop-2-enyl)-1,4-dioxaspiro[4.5]decane has a molecular weight of 222.33 g/mol, XLogP of 3.44, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-bis(prop-2-enyl)-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 567107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).