C14H18N2OS — CID 106323063
cis-(1S,3R)-3-(6-ethoxy-1,3-benzothiazol-2-yl)cyclopentan-1-amine (PubChem CID 106323063) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is cis-(1S,3R)-3-(6-ethoxy-1,3-benzothiazol-2-yl)cyclopentan-1-amine.
| Compound Name | cis-(1S,3R)-3-(6-ethoxy-1,3-benzothiazol-2-yl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 106323063 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | cis-(1S,3R)-3-(6-ethoxy-1,3-benzothiazol-2-yl)cyclopentan-1-amine |
| SMILES | CCOc1ccc2nc([C@@H]3CC[C@H](N)C3)sc2c1 |
| InChI | InChI=1S/C14H18N2OS/c1-2-17-11-5-6-12-13(8-11)18-14(16-12)9-3-4-10(15)7-9/h5-6,8-10H,2-4,7,15H2,1H3/t9-,10+/m1/s1 |
| InChIKey | JUEBWIZJKJHQAZ-ZJUUUORDSA-N |
| XLogP | 3.29 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |