C15H33NSi — CID 106323361
[4-tert-butyl-1-(trimethylsilylmethyl)cyclohexyl]methanamine (PubChem CID 106323361) has the molecular formula C15H33NSi and a molecular weight of 255.52 g/mol. Its IUPAC name is [4-tert-butyl-1-(trimethylsilylmethyl)cyclohexyl]methanamine.
| Compound Name | [4-tert-butyl-1-(trimethylsilylmethyl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 106323361 |
| Molecular Formula | C15H33NSi |
| Molecular Weight | 255.52 g/mol |
| Exact Mass | 255.24 |
| IUPAC Name | [4-tert-butyl-1-(trimethylsilylmethyl)cyclohexyl]methanamine |
| SMILES | CC(C)(C)C1CCC(CN)(C[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C15H33NSi/c1-14(2,3)13-7-9-15(11-16,10-8-13)12-17(4,5)6/h13H,7-12,16H2,1-6H3 |
| InChIKey | KAFCXMSKRKZDCT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|