C19H41NSi — CID 106323491
N-[[4-tert-butyl-1-(trimethylsilylmethyl)cyclohexyl]methyl]-2-methylpropan-2-amine (PubChem CID 106323491) has the molecular formula C19H41NSi and a molecular weight of 311.63 g/mol. Its IUPAC name is N-[[4-tert-butyl-1-(trimethylsilylmethyl)cyclohexyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[4-tert-butyl-1-(trimethylsilylmethyl)cyclohexyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 106323491 |
| Molecular Formula | C19H41NSi |
| Molecular Weight | 311.63 g/mol |
| Exact Mass | 311.30 |
| IUPAC Name | N-[[4-tert-butyl-1-(trimethylsilylmethyl)cyclohexyl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCC1(C[Si](C)(C)C)CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H41NSi/c1-17(2,3)16-10-12-19(13-11-16,15-21(7,8)9)14-20-18(4,5)6/h16,20H,10-15H2,1-9H3 |
| InChIKey | CXVHTJKZTRAWRK-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.63 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|