C15H31BrSi — CID 106324159
[1-(bromomethyl)-4-tert-butylcyclohexyl]methyl-trimethylsilane (PubChem CID 106324159) has the molecular formula C15H31BrSi and a molecular weight of 319.40 g/mol. Its IUPAC name is [1-(bromomethyl)-4-tert-butylcyclohexyl]methyl-trimethylsilane.
| Compound Name | [1-(bromomethyl)-4-tert-butylcyclohexyl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 106324159 |
| Molecular Formula | C15H31BrSi |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | [1-(bromomethyl)-4-tert-butylcyclohexyl]methyl-trimethylsilane |
| SMILES | CC(C)(C)C1CCC(CBr)(C[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C15H31BrSi/c1-14(2,3)13-7-9-15(11-16,10-8-13)12-17(4,5)6/h13H,7-12H2,1-6H3 |
| InChIKey | KVHMJPKPEJWXGD-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|