C11H19Br3 — CID 101064308
(1S,2R,4S)-1,2-dibromo-1-(bromomethyl)-4-tert-butylcyclohexane (PubChem CID 101064308) has the molecular formula C11H19Br3 and a molecular weight of 390.99 g/mol. Its IUPAC name is (1S,2R,4S)-1,2-dibromo-1-(bromomethyl)-4-tert-butylcyclohexane.
| Compound Name | (1S,2R,4S)-1,2-dibromo-1-(bromomethyl)-4-tert-butylcyclohexane |
|---|---|
| PubChem CID | 101064308 |
| Molecular Formula | C11H19Br3 |
| Molecular Weight | 390.99 g/mol |
| Exact Mass | 387.90 |
| IUPAC Name | (1S,2R,4S)-1,2-dibromo-1-(bromomethyl)-4-tert-butylcyclohexane |
| SMILES | CC(C)(C)[C@H]1CC[C@](Br)(CBr)[C@H](Br)C1 |
| InChI | InChI=1S/C11H19Br3/c1-10(2,3)8-4-5-11(14,7-12)9(13)6-8/h8-9H,4-7H2,1-3H3/t8-,9+,11-/m0/s1 |
| InChIKey | OHEZJFFKIJJKRW-NGZCFLSTSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.99 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|