C10H16Br4 — CID 124934804
(1S,2R,4S)-1,2-dibromo-4-[(2S)-1,2-dibromopropan-2-yl]-1-methylcyclohexane (PubChem CID 124934804) has the molecular formula C10H16Br4 and a molecular weight of 455.85 g/mol. Its IUPAC name is (1S,2R,4S)-1,2-dibromo-4-[(2S)-1,2-dibromopropan-2-yl]-1-methylcyclohexane.
| Compound Name | (1S,2R,4S)-1,2-dibromo-4-[(2S)-1,2-dibromopropan-2-yl]-1-methylcyclohexane |
|---|---|
| PubChem CID | 124934804 |
| Molecular Formula | C10H16Br4 |
| Molecular Weight | 455.85 g/mol |
| Exact Mass | 451.80 |
| IUPAC Name | (1S,2R,4S)-1,2-dibromo-4-[(2S)-1,2-dibromopropan-2-yl]-1-methylcyclohexane |
| SMILES | C[C@]1(Br)CC[C@H]([C@](C)(Br)CBr)C[C@H]1Br |
| InChI | InChI=1S/C10H16Br4/c1-9(13)4-3-7(5-8(9)12)10(2,14)6-11/h7-8H,3-6H2,1-2H3/t7-,8+,9-,10+/m0/s1 |
| InChIKey | BQAKZPPEUZUAJR-QCLAVDOMSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.85 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|