C15H26BrClO2 — CID 162877139
(E,6R)-6-[(1R,3R,4R)-4-bromo-3-chloro-4-methylcyclohexyl]-2-methylhept-3-ene-2,6-diol (PubChem CID 162877139) has the molecular formula C15H26BrClO2 and a molecular weight of 353.73 g/mol. Its IUPAC name is (E,6R)-6-[(1R,3R,4R)-4-bromo-3-chloro-4-methylcyclohexyl]-2-methylhept-3-ene-2,6-diol.
| Compound Name | (E,6R)-6-[(1R,3R,4R)-4-bromo-3-chloro-4-methylcyclohexyl]-2-methylhept-3-ene-2,6-diol |
|---|---|
| PubChem CID | 162877139 |
| Molecular Formula | C15H26BrClO2 |
| Molecular Weight | 353.73 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | (E,6R)-6-[(1R,3R,4R)-4-bromo-3-chloro-4-methylcyclohexyl]-2-methylhept-3-ene-2,6-diol |
| SMILES | CC(C)(O)/C=C/C[C@@](C)(O)[C@@H]1CC[C@@](C)(Br)[C@H](Cl)C1 |
| InChI | InChI=1S/C15H26BrClO2/c1-13(2,18)7-5-8-15(4,19)11-6-9-14(3,16)12(17)10-11/h5,7,11-12,18-19H,6,8-10H2,1-4H3/b7-5+/t11-,12-,14-,15-/m1/s1 |
| InChIKey | FEQAISWHFUFFRA-LHKAJNKPSA-N |
| XLogP | 4.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.73 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|