C10H15Br5 — CID 102242408
1,2-dibromo-1-methyl-4-(1,1,2-tribromopropan-2-yl)cyclohexane (PubChem CID 102242408) has the molecular formula C10H15Br5 and a molecular weight of 534.75 g/mol. Its IUPAC name is 1,2-dibromo-1-methyl-4-(1,1,2-tribromopropan-2-yl)cyclohexane.
| Compound Name | 1,2-dibromo-1-methyl-4-(1,1,2-tribromopropan-2-yl)cyclohexane |
|---|---|
| PubChem CID | 102242408 |
| Molecular Formula | C10H15Br5 |
| Molecular Weight | 534.75 g/mol |
| Exact Mass | 529.71 |
| IUPAC Name | 1,2-dibromo-1-methyl-4-(1,1,2-tribromopropan-2-yl)cyclohexane |
| SMILES | CC1(Br)CCC(C(C)(Br)C(Br)Br)CC1Br |
| InChI | InChI=1S/C10H15Br5/c1-9(14)4-3-6(5-7(9)11)10(2,15)8(12)13/h6-8H,3-5H2,1-2H3 |
| InChIKey | NNOODJXBRBRSJL-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.75 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|