About N-[2-(3,4-dibromo-4-methylcyclohexyl)propan-2-yl]benzamide
N-[2-(3,4-dibromo-4-methylcyclohexyl)propan-2-yl]benzamide (PubChem CID 570927) has the molecular formula C17H23Br2NO
and a molecular weight of 417.19 g/mol. Its IUPAC name is N-[2-(3,4-dibromo-4-methylcyclohexyl)propan-2-yl]benzamide.
Molecular Properties
| Compound Name | N-[2-(3,4-dibromo-4-methylcyclohexyl)propan-2-yl]benzamide |
| PubChem CID | 570927 |
| Molecular Formula | C17H23Br2NO |
| Molecular Weight | 417.19 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | N-[2-(3,4-dibromo-4-methylcyclohexyl)propan-2-yl]benzamide |
| SMILES | CC1(Br)CCC(C(C)(C)NC(=O)c2ccccc2)CC1Br |
| InChI | InChI=1S/C17H23Br2NO/c1-16(2,13-9-10-17(3,19)14(18)11-13)20-15(21)12-7-5-4-6-8-12/h4-8,13-14H,9-11H2,1-3H3,(H,20,21) |
| InChIKey | SDEWXNPLZKSBEQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.19 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,4-dibromo-4-methylcyclohexyl)propan-2-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dibromo-4-methylcyclohexyl)propan-2-yl]benzamide?
The IUPAC name of N-[2-(3,4-dibromo-4-methylcyclohexyl)propan-2-yl]benzamide (CID 570927) is N-[2-(3,4-dibromo-4-methylcyclohexyl)propan-2-yl]benzamide.
What is the SMILES notation for N-[2-(3,4-dibromo-4-methylcyclohexyl)propan-2-yl]benzamide?
The canonical SMILES for N-[2-(3,4-dibromo-4-methylcyclohexyl)propan-2-yl]benzamide is CC1(Br)CCC(C(C)(C)NC(=O)c2ccccc2)CC1Br.
What is the InChIKey of N-[2-(3,4-dibromo-4-methylcyclohexyl)propan-2-yl]benzamide?
The InChIKey is SDEWXNPLZKSBEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23Br2NO/c1-16(2,13-9-10-17(3,19)14(18)11-13)20-15(21)12-7-5-4-6-8-12/h4-8,13-14H,9-11H2,1-3H3,(H,20,21).
What are the key properties of N-[2-(3,4-dibromo-4-methylcyclohexyl)propan-2-yl]benzamide?
N-[2-(3,4-dibromo-4-methylcyclohexyl)propan-2-yl]benzamide has a molecular weight of 417.19 g/mol, XLogP of 4.91, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dibromo-4-methylcyclohexyl)propan-2-yl]benzamide is sourced from PubChem (CID 570927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).