C20H31NO — CID 122679834
N-(4-tert-butyl-4-propan-2-ylcyclohexyl)benzamide (PubChem CID 122679834) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is N-(4-tert-butyl-4-propan-2-ylcyclohexyl)benzamide.
| Compound Name | N-(4-tert-butyl-4-propan-2-ylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 122679834 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | N-(4-tert-butyl-4-propan-2-ylcyclohexyl)benzamide |
| SMILES | CC(C)C1(C(C)(C)C)CCC(NC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H31NO/c1-15(2)20(19(3,4)5)13-11-17(12-14-20)21-18(22)16-9-7-6-8-10-16/h6-10,15,17H,11-14H2,1-5H3,(H,21,22) |
| InChIKey | WNJIFOOFZHDIDZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |