C13H31NOSi — CID 106323897
N-(2-methoxyethyl)-3,3-dimethyl-2-(trimethylsilylmethyl)butan-1-amine (PubChem CID 106323897) has the molecular formula C13H31NOSi and a molecular weight of 245.48 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3,3-dimethyl-2-(trimethylsilylmethyl)butan-1-amine.
| Compound Name | N-(2-methoxyethyl)-3,3-dimethyl-2-(trimethylsilylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 106323897 |
| Molecular Formula | C13H31NOSi |
| Molecular Weight | 245.48 g/mol |
| Exact Mass | 245.22 |
| IUPAC Name | N-(2-methoxyethyl)-3,3-dimethyl-2-(trimethylsilylmethyl)butan-1-amine |
| SMILES | COCCNCC(C[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H31NOSi/c1-13(2,3)12(11-16(5,6)7)10-14-8-9-15-4/h12,14H,8-11H2,1-7H3 |
| InChIKey | FAJOAQSXHBNBJM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|