C12H27NSi — CID 106323978
2-methyl-N-propyl-2-(trimethylsilylmethyl)but-3-en-1-amine (PubChem CID 106323978) has the molecular formula C12H27NSi and a molecular weight of 213.44 g/mol. Its IUPAC name is 2-methyl-N-propyl-2-(trimethylsilylmethyl)but-3-en-1-amine.
| Compound Name | 2-methyl-N-propyl-2-(trimethylsilylmethyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 106323978 |
| Molecular Formula | C12H27NSi |
| Molecular Weight | 213.44 g/mol |
| Exact Mass | 213.19 |
| IUPAC Name | 2-methyl-N-propyl-2-(trimethylsilylmethyl)but-3-en-1-amine |
| SMILES | C=CC(C)(CNCCC)C[Si](C)(C)C |
| InChI | InChI=1S/C12H27NSi/c1-7-9-13-10-12(3,8-2)11-14(4,5)6/h8,13H,2,7,9-11H2,1,3-6H3 |
| InChIKey | RCKBMQYEBSTPSZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|