C13H21BrO2Si — CID 106324292
2-(4-bromophenyl)-2-(trimethylsilylmethyl)propane-1,3-diol (PubChem CID 106324292) has the molecular formula C13H21BrO2Si and a molecular weight of 317.30 g/mol. Its IUPAC name is 2-(4-bromophenyl)-2-(trimethylsilylmethyl)propane-1,3-diol.
| Compound Name | 2-(4-bromophenyl)-2-(trimethylsilylmethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 106324292 |
| Molecular Formula | C13H21BrO2Si |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-(4-bromophenyl)-2-(trimethylsilylmethyl)propane-1,3-diol |
| SMILES | C[Si](C)(C)CC(CO)(CO)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H21BrO2Si/c1-17(2,3)10-13(8-15,9-16)11-4-6-12(14)7-5-11/h4-7,15-16H,8-10H2,1-3H3 |
| InChIKey | TYMRUNYNHNKBPL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|