C18H21BrO2 — CID 79445511
2-(4-bromophenyl)-2-[(4-ethylphenyl)methyl]propane-1,3-diol (PubChem CID 79445511) has the molecular formula C18H21BrO2 and a molecular weight of 349.27 g/mol. Its IUPAC name is 2-(4-bromophenyl)-2-[(4-ethylphenyl)methyl]propane-1,3-diol.
| Compound Name | 2-(4-bromophenyl)-2-[(4-ethylphenyl)methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 79445511 |
| Molecular Formula | C18H21BrO2 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 2-(4-bromophenyl)-2-[(4-ethylphenyl)methyl]propane-1,3-diol |
| SMILES | CCc1ccc(CC(CO)(CO)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C18H21BrO2/c1-2-14-3-5-15(6-4-14)11-18(12-20,13-21)16-7-9-17(19)10-8-16/h3-10,20-21H,2,11-13H2,1H3 |
| InChIKey | UOMVBTMDGBKSFI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |