About 1-bromo-4-ethylbenzene;N-methylmethanamine
1-bromo-4-ethylbenzene;N-methylmethanamine (PubChem CID 143984882) has the molecular formula C10H16BrN
and a molecular weight of 230.15 g/mol. Its IUPAC name is 1-bromo-4-ethylbenzene;N-methylmethanamine.
Molecular Properties
| Compound Name | 1-bromo-4-ethylbenzene;N-methylmethanamine |
| PubChem CID | 143984882 |
| Molecular Formula | C10H16BrN |
| Molecular Weight | 230.15 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 1-bromo-4-ethylbenzene;N-methylmethanamine |
| SMILES | CCc1ccc(Br)cc1.CNC |
| InChI | InChI=1S/C8H9Br.C2H7N/c1-2-7-3-5-8(9)6-4-7;1-3-2/h3-6H,2H2,1H3;3H,1-2H3 |
| InChIKey | XOJAEXOLOOSUME-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.15 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-4-ethylbenzene;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-ethylbenzene;N-methylmethanamine?
The IUPAC name of 1-bromo-4-ethylbenzene;N-methylmethanamine (CID 143984882) is 1-bromo-4-ethylbenzene;N-methylmethanamine.
What is the SMILES notation for 1-bromo-4-ethylbenzene;N-methylmethanamine?
The canonical SMILES for 1-bromo-4-ethylbenzene;N-methylmethanamine is CCc1ccc(Br)cc1.CNC.
What is the InChIKey of 1-bromo-4-ethylbenzene;N-methylmethanamine?
The InChIKey is XOJAEXOLOOSUME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Br.C2H7N/c1-2-7-3-5-8(9)6-4-7;1-3-2/h3-6H,2H2,1H3;3H,1-2H3.
What are the key properties of 1-bromo-4-ethylbenzene;N-methylmethanamine?
1-bromo-4-ethylbenzene;N-methylmethanamine has a molecular weight of 230.15 g/mol, XLogP of 2.85, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-ethylbenzene;N-methylmethanamine is sourced from PubChem (CID 143984882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).