C14H22N2O2S — CID 106324919
4-[1-(2-thiomorpholin-4-ylethylamino)ethyl]benzene-1,3-diol (PubChem CID 106324919) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 4-[1-(2-thiomorpholin-4-ylethylamino)ethyl]benzene-1,3-diol.
| Compound Name | 4-[1-(2-thiomorpholin-4-ylethylamino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 106324919 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 4-[1-(2-thiomorpholin-4-ylethylamino)ethyl]benzene-1,3-diol |
| SMILES | CC(NCCN1CCSCC1)c1ccc(O)cc1O |
| InChI | InChI=1S/C14H22N2O2S/c1-11(13-3-2-12(17)10-14(13)18)15-4-5-16-6-8-19-9-7-16/h2-3,10-11,15,17-18H,4-9H2,1H3 |
| InChIKey | IZOGRYUUFKMVSM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|