C13H14O3 — CID 10632604
(2R,5S,8S)-12-methyl-4,9-dioxatetracyclo[8.4.0.02,5.05,8]tetradeca-1(10),11,13-trien-2-ol (PubChem CID 10632604) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (2R,5S,8S)-12-methyl-4,9-dioxatetracyclo[8.4.0.02,5.05,8]tetradeca-1(10),11,13-trien-2-ol.
| Compound Name | (2R,5S,8S)-12-methyl-4,9-dioxatetracyclo[8.4.0.02,5.05,8]tetradeca-1(10),11,13-trien-2-ol |
|---|---|
| PubChem CID | 10632604 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (2R,5S,8S)-12-methyl-4,9-dioxatetracyclo[8.4.0.02,5.05,8]tetradeca-1(10),11,13-trien-2-ol |
| SMILES | Cc1ccc2c(c1)O[C@H]1CC[C@]13OC[C@]23O |
| InChI | InChI=1S/C13H14O3/c1-8-2-3-9-10(6-8)16-11-4-5-13(11)12(9,14)7-15-13/h2-3,6,11,14H,4-5,7H2,1H3/t11-,12-,13-/m0/s1 |
| InChIKey | SXFNEIAWRHXZFN-AVGNSLFASA-N |
| XLogP | 1.51 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |