C15H23ClN2O2S — CID 106332802
N-[3-[(6-chloro-2,2-dimethyl-1,3-dihydroinden-1-yl)amino]propyl]methanesulfonamide (PubChem CID 106332802) has the molecular formula C15H23ClN2O2S and a molecular weight of 330.88 g/mol. Its IUPAC name is N-[3-[(6-chloro-2,2-dimethyl-1,3-dihydroinden-1-yl)amino]propyl]methanesulfonamide.
| Compound Name | N-[3-[(6-chloro-2,2-dimethyl-1,3-dihydroinden-1-yl)amino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 106332802 |
| Molecular Formula | C15H23ClN2O2S |
| Molecular Weight | 330.88 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-[3-[(6-chloro-2,2-dimethyl-1,3-dihydroinden-1-yl)amino]propyl]methanesulfonamide |
| SMILES | CC1(C)Cc2ccc(Cl)cc2C1NCCCNS(C)(=O)=O |
| InChI | InChI=1S/C15H23ClN2O2S/c1-15(2)10-11-5-6-12(16)9-13(11)14(15)17-7-4-8-18-21(3,19)20/h5-6,9,14,17-18H,4,7-8,10H2,1-3H3 |
| InChIKey | SLMDSKMCZJOGGR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.88 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|