About 3-[(6-chloro-2,2-dimethyl-1,3-dihydroinden-1-yl)amino]propan-1-ol
3-[(6-chloro-2,2-dimethyl-1,3-dihydroinden-1-yl)amino]propan-1-ol (PubChem CID 83067295) has the molecular formula C14H20ClNO
and a molecular weight of 253.77 g/mol. Its IUPAC name is 3-[(6-chloro-2,2-dimethyl-1,3-dihydroinden-1-yl)amino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(6-chloro-2,2-dimethyl-1,3-dihydroinden-1-yl)amino]propan-1-ol |
| PubChem CID | 83067295 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 3-[(6-chloro-2,2-dimethyl-1,3-dihydroinden-1-yl)amino]propan-1-ol |
| SMILES | CC1(C)Cc2ccc(Cl)cc2C1NCCCO |
| InChI | InChI=1S/C14H20ClNO/c1-14(2)9-10-4-5-11(15)8-12(10)13(14)16-6-3-7-17/h4-5,8,13,16-17H,3,6-7,9H2,1-2H3 |
| InChIKey | DDGOVQAAUVJHIL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(6-chloro-2,2-dimethyl-1,3-dihydroinden-1-yl)amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-chloro-2,2-dimethyl-1,3-dihydroinden-1-yl)amino]propan-1-ol?
The IUPAC name of 3-[(6-chloro-2,2-dimethyl-1,3-dihydroinden-1-yl)amino]propan-1-ol (CID 83067295) is 3-[(6-chloro-2,2-dimethyl-1,3-dihydroinden-1-yl)amino]propan-1-ol.
What is the SMILES notation for 3-[(6-chloro-2,2-dimethyl-1,3-dihydroinden-1-yl)amino]propan-1-ol?
The canonical SMILES for 3-[(6-chloro-2,2-dimethyl-1,3-dihydroinden-1-yl)amino]propan-1-ol is CC1(C)Cc2ccc(Cl)cc2C1NCCCO.
What is the InChIKey of 3-[(6-chloro-2,2-dimethyl-1,3-dihydroinden-1-yl)amino]propan-1-ol?
The InChIKey is DDGOVQAAUVJHIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClNO/c1-14(2)9-10-4-5-11(15)8-12(10)13(14)16-6-3-7-17/h4-5,8,13,16-17H,3,6-7,9H2,1-2H3.
What are the key properties of 3-[(6-chloro-2,2-dimethyl-1,3-dihydroinden-1-yl)amino]propan-1-ol?
3-[(6-chloro-2,2-dimethyl-1,3-dihydroinden-1-yl)amino]propan-1-ol has a molecular weight of 253.77 g/mol, XLogP of 2.94, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-chloro-2,2-dimethyl-1,3-dihydroinden-1-yl)amino]propan-1-ol is sourced from PubChem (CID 83067295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).