C11H22O5 — CID 10633439
cis-(1R,2S)-4,4-dimethoxy-2-(2-methoxypropan-2-yloxy)cyclopentan-1-ol (PubChem CID 10633439) has the molecular formula C11H22O5 and a molecular weight of 234.29 g/mol. Its IUPAC name is cis-(1R,2S)-4,4-dimethoxy-2-(2-methoxypropan-2-yloxy)cyclopentan-1-ol.
| Compound Name | cis-(1R,2S)-4,4-dimethoxy-2-(2-methoxypropan-2-yloxy)cyclopentan-1-ol |
|---|---|
| PubChem CID | 10633439 |
| Molecular Formula | C11H22O5 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | cis-(1R,2S)-4,4-dimethoxy-2-(2-methoxypropan-2-yloxy)cyclopentan-1-ol |
| SMILES | COC(C)(C)O[C@H]1CC(OC)(OC)C[C@H]1O |
| InChI | InChI=1S/C11H22O5/c1-10(2,13-3)16-9-7-11(14-4,15-5)6-8(9)12/h8-9,12H,6-7H2,1-5H3/t8-,9+/m1/s1 |
| InChIKey | YYBYOWPCZLBWOV-BDAKNGLRSA-N |
| XLogP | 0.90 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|