C16H13NO — CID 10633518
(2E)-2-(4-methoxy-2,3-dihydrophenalen-1-ylidene)acetonitrile (PubChem CID 10633518) has the molecular formula C16H13NO and a molecular weight of 235.29 g/mol. Its IUPAC name is (2E)-2-(4-methoxy-2,3-dihydrophenalen-1-ylidene)acetonitrile.
| Compound Name | (2E)-2-(4-methoxy-2,3-dihydrophenalen-1-ylidene)acetonitrile |
|---|---|
| PubChem CID | 10633518 |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | (2E)-2-(4-methoxy-2,3-dihydrophenalen-1-ylidene)acetonitrile |
| SMILES | COc1ccc2cccc3c2c1CC/C3=C\C#N |
| InChI | InChI=1S/C16H13NO/c1-18-15-8-6-12-3-2-4-13-11(9-10-17)5-7-14(15)16(12)13/h2-4,6,8-9H,5,7H2,1H3/b11-9+ |
| InChIKey | NGEJALCGJKTPJX-PKNBQFBNSA-N |
| XLogP | 3.70 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|