C16H16O2 — CID 135038714
2,8-dimethoxytricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8,11-hexaene (PubChem CID 135038714) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is 2,8-dimethoxytricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8,11-hexaene.
| Compound Name | 2,8-dimethoxytricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8,11-hexaene |
|---|---|
| PubChem CID | 135038714 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2,8-dimethoxytricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8,11-hexaene |
| SMILES | COc1ccc2ccc(OC)c3c2c1CC=CC3 |
| InChI | InChI=1S/C16H16O2/c1-17-14-9-7-11-8-10-15(18-2)13-6-4-3-5-12(14)16(11)13/h3-4,7-10H,5-6H2,1-2H3 |
| InChIKey | JHYRBKKQKWCCTJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|