About 5-methoxy-3,4-dihydronaphthalene-2-carbonitrile
5-methoxy-3,4-dihydronaphthalene-2-carbonitrile (PubChem CID 10845215) has the molecular formula C12H11NO
and a molecular weight of 185.23 g/mol. Its IUPAC name is 5-methoxy-3,4-dihydronaphthalene-2-carbonitrile.
Molecular Properties
| Compound Name | 5-methoxy-3,4-dihydronaphthalene-2-carbonitrile |
| PubChem CID | 10845215 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 5-methoxy-3,4-dihydronaphthalene-2-carbonitrile |
| SMILES | COc1cccc2c1CCC(C#N)=C2 |
| InChI | InChI=1S/C12H11NO/c1-14-12-4-2-3-10-7-9(8-13)5-6-11(10)12/h2-4,7H,5-6H2,1H3 |
| InChIKey | UIRBTYLHDFGCBO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methoxy-3,4-dihydronaphthalene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-3,4-dihydronaphthalene-2-carbonitrile?
The IUPAC name of 5-methoxy-3,4-dihydronaphthalene-2-carbonitrile (CID 10845215) is 5-methoxy-3,4-dihydronaphthalene-2-carbonitrile.
What is the SMILES notation for 5-methoxy-3,4-dihydronaphthalene-2-carbonitrile?
The canonical SMILES for 5-methoxy-3,4-dihydronaphthalene-2-carbonitrile is COc1cccc2c1CCC(C#N)=C2.
What is the InChIKey of 5-methoxy-3,4-dihydronaphthalene-2-carbonitrile?
The InChIKey is UIRBTYLHDFGCBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO/c1-14-12-4-2-3-10-7-9(8-13)5-6-11(10)12/h2-4,7H,5-6H2,1H3.
What are the key properties of 5-methoxy-3,4-dihydronaphthalene-2-carbonitrile?
5-methoxy-3,4-dihydronaphthalene-2-carbonitrile has a molecular weight of 185.23 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-3,4-dihydronaphthalene-2-carbonitrile is sourced from PubChem (CID 10845215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).