C11H21N5O4S — CID 106338856
N,N-dimethyl-2-[(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)amino]ethanesulfonamide (PubChem CID 106338856) has the molecular formula C11H21N5O4S and a molecular weight of 319.39 g/mol. Its IUPAC name is N,N-dimethyl-2-[(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)amino]ethanesulfonamide.
| Compound Name | N,N-dimethyl-2-[(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 106338856 |
| Molecular Formula | C11H21N5O4S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | N,N-dimethyl-2-[(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)amino]ethanesulfonamide |
| SMILES | CC(C)c1nn(C)c(NCCS(=O)(=O)N(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H21N5O4S/c1-8(2)9-10(16(17)18)11(15(5)13-9)12-6-7-21(19,20)14(3)4/h8,12H,6-7H2,1-5H3 |
| InChIKey | SOASPWXKJSZSDN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|