C13H23N5O3 — CID 66018195
3-[(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)amino]-N-propylpropanamide (PubChem CID 66018195) has the molecular formula C13H23N5O3 and a molecular weight of 297.36 g/mol. Its IUPAC name is 3-[(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)amino]-N-propylpropanamide.
| Compound Name | 3-[(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 66018195 |
| Molecular Formula | C13H23N5O3 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 3-[(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCNc1c([N+](=O)[O-])c(C(C)C)nn1C |
| InChI | InChI=1S/C13H23N5O3/c1-5-7-14-10(19)6-8-15-13-12(18(20)21)11(9(2)3)16-17(13)4/h9,15H,5-8H2,1-4H3,(H,14,19) |
| InChIKey | JEVCKWUQDNFHGC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|