C12H20N4O5 — CID 103153761
3-methoxy-4-[(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)amino]butanoic acid (PubChem CID 103153761) has the molecular formula C12H20N4O5 and a molecular weight of 300.32 g/mol. Its IUPAC name is 3-methoxy-4-[(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)amino]butanoic acid.
| Compound Name | 3-methoxy-4-[(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 103153761 |
| Molecular Formula | C12H20N4O5 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 3-methoxy-4-[(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)amino]butanoic acid |
| SMILES | COC(CNc1c([N+](=O)[O-])c(C(C)C)nn1C)CC(=O)O |
| InChI | InChI=1S/C12H20N4O5/c1-7(2)10-11(16(19)20)12(15(3)14-10)13-6-8(21-4)5-9(17)18/h7-8,13H,5-6H2,1-4H3,(H,17,18) |
| InChIKey | KZYRQNWTPZGCAV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|