C10H15F3N4O2S — CID 106431021
1-methyl-4-nitro-3-propan-2-yl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrazol-5-amine (PubChem CID 106431021) has the molecular formula C10H15F3N4O2S and a molecular weight of 312.32 g/mol. Its IUPAC name is 1-methyl-4-nitro-3-propan-2-yl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrazol-5-amine.
| Compound Name | 1-methyl-4-nitro-3-propan-2-yl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 106431021 |
| Molecular Formula | C10H15F3N4O2S |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 1-methyl-4-nitro-3-propan-2-yl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrazol-5-amine |
| SMILES | CC(C)c1nn(C)c(NCCSC(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H15F3N4O2S/c1-6(2)7-8(17(18)19)9(16(3)15-7)14-4-5-20-10(11,12)13/h6,14H,4-5H2,1-3H3 |
| InChIKey | XTICAZMSIDWJHR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|