C8H11F3O3S — CID 10634023
ethyl 2-ethylsulfanyl-4,4,4-trifluoro-3-oxobutanoate (PubChem CID 10634023) has the molecular formula C8H11F3O3S and a molecular weight of 244.23 g/mol. Its IUPAC name is ethyl 2-ethylsulfanyl-4,4,4-trifluoro-3-oxobutanoate.
| Compound Name | ethyl 2-ethylsulfanyl-4,4,4-trifluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 10634023 |
| Molecular Formula | C8H11F3O3S |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | ethyl 2-ethylsulfanyl-4,4,4-trifluoro-3-oxobutanoate |
| SMILES | CCOC(=O)C(SCC)C(=O)C(F)(F)F |
| InChI | InChI=1S/C8H11F3O3S/c1-3-14-7(13)5(15-4-2)6(12)8(9,10)11/h5H,3-4H2,1-2H3 |
| InChIKey | PNGYPPUTYXXEMR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|