C9H17N3O5S2 — CID 106340340
(4R)-3-[3-(methanesulfonamido)propylcarbamoyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 106340340) has the molecular formula C9H17N3O5S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is (4R)-3-[3-(methanesulfonamido)propylcarbamoyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-[3-(methanesulfonamido)propylcarbamoyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 106340340 |
| Molecular Formula | C9H17N3O5S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | (4R)-3-[3-(methanesulfonamido)propylcarbamoyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CS(=O)(=O)NCCCNC(=O)N1CSC[C@H]1C(=O)O |
| InChI | InChI=1S/C9H17N3O5S2/c1-19(16,17)11-4-2-3-10-9(15)12-6-18-5-7(12)8(13)14/h7,11H,2-6H2,1H3,(H,10,15)(H,13,14)/t7-/m0/s1 |
| InChIKey | BFQKMOYJPMPZQS-ZETCQYMHSA-N |
| XLogP | -0.91 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|