C11H20N2O3S — CID 63003765
(4R)-3-(4-methylpentylcarbamoyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 63003765) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is (4R)-3-(4-methylpentylcarbamoyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-(4-methylpentylcarbamoyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 63003765 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (4R)-3-(4-methylpentylcarbamoyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC(C)CCCNC(=O)N1CSC[C@H]1C(=O)O |
| InChI | InChI=1S/C11H20N2O3S/c1-8(2)4-3-5-12-11(16)13-7-17-6-9(13)10(14)15/h8-9H,3-7H2,1-2H3,(H,12,16)(H,14,15)/t9-/m0/s1 |
| InChIKey | XVARZZVQJJISLL-VIFPVBQESA-N |
| XLogP | 1.59 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|