C8H11F3N2O3S2 — CID 106431555
(4R)-3-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 106431555) has the molecular formula C8H11F3N2O3S2 and a molecular weight of 304.32 g/mol. Its IUPAC name is (4R)-3-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 106431555 |
| Molecular Formula | C8H11F3N2O3S2 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | (4R)-3-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CSCN1C(=O)NCCSC(F)(F)F |
| InChI | InChI=1S/C8H11F3N2O3S2/c9-8(10,11)18-2-1-12-7(16)13-4-17-3-5(13)6(14)15/h5H,1-4H2,(H,12,16)(H,14,15)/t5-/m0/s1 |
| InChIKey | PVUJYHNBIGAFKL-YFKPBYRVSA-N |
| XLogP | 1.41 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|