C11H17F3N2O3S2 — CID 106431416
2-propan-2-yl-3-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 106431416) has the molecular formula C11H17F3N2O3S2 and a molecular weight of 346.40 g/mol. Its IUPAC name is 2-propan-2-yl-3-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-propan-2-yl-3-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 106431416 |
| Molecular Formula | C11H17F3N2O3S2 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 2-propan-2-yl-3-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC(C)C1SCC(C(=O)O)N1C(=O)NCCSC(F)(F)F |
| InChI | InChI=1S/C11H17F3N2O3S2/c1-6(2)8-16(7(5-20-8)9(17)18)10(19)15-3-4-21-11(12,13)14/h6-8H,3-5H2,1-2H3,(H,15,19)(H,17,18) |
| InChIKey | WVVRGOIXMLVGOO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|