C9H13F3N2O3S2 — CID 114188110
2-methyl-3-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 114188110) has the molecular formula C9H13F3N2O3S2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 2-methyl-3-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-methyl-3-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 114188110 |
| Molecular Formula | C9H13F3N2O3S2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 2-methyl-3-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC1SCC(C(=O)O)N1C(=O)NCCSC(F)(F)F |
| InChI | InChI=1S/C9H13F3N2O3S2/c1-5-14(6(4-18-5)7(15)16)8(17)13-2-3-19-9(10,11)12/h5-6H,2-4H2,1H3,(H,13,17)(H,15,16) |
| InChIKey | IPOZSTCKAMHUPF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|