C10H15N5O5S — CID 106342495
2-(methylamino)-N-[2-(methylsulfamoyl)ethyl]-5-nitropyridine-3-carboxamide (PubChem CID 106342495) has the molecular formula C10H15N5O5S and a molecular weight of 317.33 g/mol. Its IUPAC name is 2-(methylamino)-N-[2-(methylsulfamoyl)ethyl]-5-nitropyridine-3-carboxamide.
| Compound Name | 2-(methylamino)-N-[2-(methylsulfamoyl)ethyl]-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 106342495 |
| Molecular Formula | C10H15N5O5S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2-(methylamino)-N-[2-(methylsulfamoyl)ethyl]-5-nitropyridine-3-carboxamide |
| SMILES | CNc1ncc([N+](=O)[O-])cc1C(=O)NCCS(=O)(=O)NC |
| InChI | InChI=1S/C10H15N5O5S/c1-11-9-8(5-7(6-14-9)15(17)18)10(16)13-3-4-21(19,20)12-2/h5-6,12H,3-4H2,1-2H3,(H,11,14)(H,13,16) |
| InChIKey | VBDXYHAJOBMXHJ-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 143.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|