C14H21NOSi — CID 10634253
(3R,4S,5R)-4-[dimethyl(phenyl)silyl]-3,5-dimethylpyrrolidin-2-one (PubChem CID 10634253) has the molecular formula C14H21NOSi and a molecular weight of 247.41 g/mol. Its IUPAC name is (3R,4S,5R)-4-[dimethyl(phenyl)silyl]-3,5-dimethylpyrrolidin-2-one.
| Compound Name | (3R,4S,5R)-4-[dimethyl(phenyl)silyl]-3,5-dimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 10634253 |
| Molecular Formula | C14H21NOSi |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (3R,4S,5R)-4-[dimethyl(phenyl)silyl]-3,5-dimethylpyrrolidin-2-one |
| SMILES | C[C@@H]1C(=O)N[C@H](C)[C@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C14H21NOSi/c1-10-13(11(2)15-14(10)16)17(3,4)12-8-6-5-7-9-12/h5-11,13H,1-4H3,(H,15,16)/t10-,11+,13-/m0/s1 |
| InChIKey | BDDZCICEZIIVCP-LOWVWBTDSA-N |
| XLogP | 2.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|