C8H14N4O2S — CID 106343060
2-[(6-amino-2-pyridinyl)amino]-N-methylethanesulfonamide (PubChem CID 106343060) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 2-[(6-amino-2-pyridinyl)amino]-N-methylethanesulfonamide.
| Compound Name | 2-[(6-amino-2-pyridinyl)amino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 106343060 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 2-[(6-amino-2-pyridinyl)amino]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNc1cccc(N)n1 |
| InChI | InChI=1S/C8H14N4O2S/c1-10-15(13,14)6-5-11-8-4-2-3-7(9)12-8/h2-4,10H,5-6H2,1H3,(H3,9,11,12) |
| InChIKey | ZNZWSGHIVIXSGM-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |