C8H17N3O — CID 106347302
2-(1-aminopropylideneamino)-3-methylbutanamide (PubChem CID 106347302) has the molecular formula C8H17N3O and a molecular weight of 171.24 g/mol. Its IUPAC name is 2-(1-aminopropylideneamino)-3-methylbutanamide.
| Compound Name | 2-(1-aminopropylideneamino)-3-methylbutanamide |
|---|---|
| PubChem CID | 106347302 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 2-(1-aminopropylideneamino)-3-methylbutanamide |
| SMILES | CC/C(N)=N\C(C(N)=O)C(C)C |
| InChI | InChI=1S/C8H17N3O/c1-4-6(9)11-7(5(2)3)8(10)12/h5,7H,4H2,1-3H3,(H2,9,11)(H2,10,12) |
| InChIKey | OMUQNLFYAVXZTP-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|