C9H19N3O — CID 123669719
N'-(2-amino-3-oxobutyl)-2-methylbutanimidamide (PubChem CID 123669719) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is N'-(2-amino-3-oxobutyl)-2-methylbutanimidamide.
| Compound Name | N'-(2-amino-3-oxobutyl)-2-methylbutanimidamide |
|---|---|
| PubChem CID | 123669719 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | N'-(2-amino-3-oxobutyl)-2-methylbutanimidamide |
| SMILES | CCC(C)/C(N)=N/CC(N)C(C)=O |
| InChI | InChI=1S/C9H19N3O/c1-4-6(2)9(11)12-5-8(10)7(3)13/h6,8H,4-5,10H2,1-3H3,(H2,11,12) |
| InChIKey | OWRRJIQOKFKCHU-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|